EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21Cl6N3O2S |
| Net Charge | 0 |
| Average Mass | 532.148 |
| Monoisotopic Mass | 528.94856 |
| SMILES | C[C@H](NC(=O)[C@H](C[C@H](C)C(Cl)(Cl)Cl)NC(=O)C[C@H](C)C(Cl)(Cl)Cl)c1nccs1 |
| InChI | InChI=1S/C16H21Cl6N3O2S/c1-8(15(17,18)19)6-11(25-12(26)7-9(2)16(20,21)22)13(27)24-10(3)14-23-4-5-28-14/h4-5,8-11H,6-7H2,1-3H3,(H,24,27)(H,25,26)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | JXAGQUPIAAXRDS-NAKRPEOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | DOI (10.1021/np000462q) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nordysidenin (CHEBI:200112) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S,4S)-5,5,5-trichloro-4-methyl-N-[(1S)-1-(1,3-thiazol-2-yl)ethyl]-2-[[(3S)-4,4,4-trichloro-3-methylbutanoyl]amino]pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 8896344 | ChemSpider |