EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O4 |
| Net Charge | 0 |
| Average Mass | 300.314 |
| Monoisotopic Mass | 300.11101 |
| SMILES | CC(=O)OCc1cc2c(nc3ccccc32)c([C@@H](O)CO)n1 |
| InChI | InChI=1S/C16H16N2O4/c1-9(20)22-8-10-6-12-11-4-2-3-5-13(11)18-15(12)16(17-10)14(21)7-19/h2-6,14,18-19,21H,7-8H2,1H3/t14-/m0/s1 |
| InChIKey | SETMAEUYTGAAQD-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.7164/antibiotics.50.189) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyridindolol K2 (CHEBI:200096) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| [1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indol-3-yl]methyl acetate |
| Manual Xrefs | Databases |
|---|---|
| 9555955 | ChemSpider |