EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | C=C[C@]1(C)C=C2[C@@H](O)C[C@H]3C(C)(C)CCC[C@]3(C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C20H32O2/c1-6-18(4)10-11-20(22)14(13-18)15(21)12-16-17(2,3)8-7-9-19(16,20)5/h6,13,15-16,21-22H,1,7-12H2,2-5H3/t15-,16-,18-,19-,20+/m0/s1 |
| InChIKey | ZGGQYGIKHFZLQI-CZKCSJLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epicoccumspecies HS-1 (ncbitaxon:1030275) | - | PubMed (22418279) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7beta,9alpha-dihydroxypimara-8(14),15-diene (CHEBI:200073) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (2R,4aS,4bS,8aS,10S)-2-ethenyl-2,4b,8,8-tetramethyl-3,4,5,6,7,8a,9,10-octahydrophenanthrene-4a,10-diol |
| Manual Xrefs | Databases |
|---|---|
| 28530310 | ChemSpider |