EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O9 |
| Net Charge | 0 |
| Average Mass | 404.371 |
| Monoisotopic Mass | 404.11073 |
| SMILES | C[C@H]1C[C@H](O)[C@H](O)[C@]2(O[C@@H](CC(=O)O)CC3=C2C(=O)c2c(O)cccc2C3=O)O1 |
| InChI | InChI=1S/C20H20O9/c1-8-5-13(22)19(27)20(28-8)16-11(6-9(29-20)7-14(23)24)17(25)10-3-2-4-12(21)15(10)18(16)26/h2-4,8-9,13,19,21-22,27H,5-7H2,1H3,(H,23,24)/t8-,9+,13-,19-,20-/m0/s1 |
| InChIKey | VNNLNRPAIDMNEB-CIPJCBEKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (21934691) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,10R,3'S,4'S,6'S)-4'-deacetyl-griseusin B (CHEBI:200036) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| 2-[(1S,3R,3'S,4'S,6'S)-3',4',9-trihydroxy-6'-methyl-5,10-dioxospiro[3,4-dihydrobenzo[g]isochromene-1,2'-oxane]-3-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 58826674 | ChemSpider |