EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=C1[C@H]2CC[C@H](C2)C1(C)C |
| InChI | InChI=1S/C10H16/c1-7-8-4-5-9(6-8)10(7,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
| InChIKey | CRPUJAZIXJMDBK-DTWKUNHWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| IUPAC Name |
|---|
| (1R,4S)-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane |
| Synonyms | Source |
|---|---|
| (1R)-2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane | NIST Chemistry WebBook |
| (1R,4S)-2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane | IUPAC |
| (1R,4S)-(+)-camphene | NIST Chemistry WebBook |
| (+)-Camphene | KEGG COMPOUND |
| (+)-Comphene | KEGG COMPOUND |
| d-camphene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (1R,4S)-camphene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000818 | KNApSAcK |
| C06304 | KEGG COMPOUND |
| LMPR0102120011 | LIPID MAPS |