EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H28N6O8 |
| Net Charge | 0 |
| Average Mass | 396.401 |
| Monoisotopic Mass | 396.19686 |
| SMILES | NC(=O)NCC(NC(=O)[C@@H](O)[C@H](O)[C@H](N)C(O)CC(O)C(N)CO)C(N)=O |
| InChI | InChI=1S/C13H28N6O8/c14-4(3-20)6(21)1-7(22)8(15)9(23)10(24)12(26)19-5(11(16)25)2-18-13(17)27/h4-10,20-24H,1-3,14-15H2,(H2,16,25)(H,19,26)(H3,17,18,27)/t4?,5?,6?,7?,8-,9-,10+/m1/s1 |
| InChIKey | FYIPKJHNWFVEIR-WMNLMFOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus (ncbitaxon:1386) | - | DOI (10.1016/s0040-4039(00)77154-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Zwittermicin A (CHEBI:199976) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S,3R,4R)-4,8-diamino-N-[1-amino-3-(carbamoylamino)-1-oxopropan-2-yl]-2,3,5,7,9-pentahydroxynonanamide |
| Manual Xrefs | Databases |
|---|---|
| 19981807 | ChemSpider |