EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14N2O7 |
| Net Charge | 0 |
| Average Mass | 358.306 |
| Monoisotopic Mass | 358.08010 |
| SMILES | O=C(N[C@@H]1C(=O)O[C@@H]1Cc1ccc([N+](=O)[O-])cc1)c1cccc(O)c1O |
| InChI | InChI=1S/C17H14N2O7/c20-12-3-1-2-11(15(12)21)16(22)18-14-13(26-17(14)23)8-9-4-6-10(7-5-9)19(24)25/h1-7,13-14,20-21H,8H2,(H,18,22)/t13-,14+/m1/s1 |
| InChIKey | AINNQKIVZOTQBB-KGLIPLIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas (ncbitaxon:286) | - | DOI (10.1021/jo00350a010) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Obafluorin (CHEBI:199965) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2,3-dihydroxy-N-[(2R,3S)-2-[(4-nitrophenyl)methyl]-4-oxooxetan-3-yl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 129096 | ChemSpider |