EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H54N4O11 |
| Net Charge | 0 |
| Average Mass | 706.834 |
| Monoisotopic Mass | 706.37891 |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@H](CC(C)C)OC(=O)[C@H](C(C)C)OC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C35H54N4O11/c1-18(2)14-26-30(42)38-28(21(7)41)32(44)37-25(17-40)34(46)50-29(20(5)6)35(47)49-27(15-19(3)4)31(43)36-24(33(45)39(26)8)16-22-10-12-23(48-9)13-11-22/h10-13,18-21,24-29,40-41H,14-17H2,1-9H3,(H,36,43)(H,37,44)(H,38,42)/t21-,24+,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | ZYONQIAFAWQOOQ-AKFJUFKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hirsutella (ncbitaxon:42367) | - | PubMed (16309324) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hirsutatin B (CHEBI:199941) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6S,9S,12S,15S,18S)-9-[(1R)-1-hydroxyethyl]-6-(hydroxymethyl)-15-[(4-methoxyphenyl)methyl]-13-methyl-12,18-bis(2-methylpropyl)-3-propan-2-yl-1,4-dioxa-7,10,13,16-tetrazacyclooctadecane-2,5,8,11,14,17-hexone |
| Manual Xrefs | Databases |
|---|---|
| 9796534 | ChemSpider |