EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41N3O5 |
| Net Charge | 0 |
| Average Mass | 439.597 |
| Monoisotopic Mass | 439.30462 |
| SMILES | CCCCC(C)C1CC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)O1 |
| InChI | InChI=1S/C23H41N3O5/c1-8-9-10-15(6)18-12-19(27)26-20(14(4)5)22(29)24-16(7)21(28)25-17(11-13(2)3)23(30)31-18/h13-18,20H,8-12H2,1-7H3,(H,24,29)(H,25,28)(H,26,27)/t15?,16-,17+,18?,20-/m0/s1 |
| InChIKey | QYCQLTKYMZKSTQ-XKRKNNOESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria (ncbitaxon:5581) | - | PubMed (15032479) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Beauveriolide VI (CHEBI:199935) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6S,9S)-13-hexan-2-yl-6-methyl-3-(2-methylpropyl)-9-propan-2-yl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 8400716 | ChemSpider |