EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H41NO12S |
| Net Charge | 0 |
| Average Mass | 687.764 |
| Monoisotopic Mass | 687.23495 |
| SMILES | CC(=O)N[C@H](CSC[C@@H]1OC(=O)[C@@]2(C1=O)C(=O)[C@@]1(C)[C@@H](C=C[C@H]3[C@H](O)[C@@H](C)[C@H](OC(C)=O)C[C@@H]31)C[C@H]2C=CC=CC=CC(=O)O)C(=O)O |
| InChI | InChI=1S/C34H41NO12S/c1-17-25(46-19(3)37)14-23-22(28(17)40)12-11-20-13-21(9-7-5-6-8-10-27(38)39)34(31(44)33(20,23)4)29(41)26(47-32(34)45)16-48-15-24(30(42)43)35-18(2)36/h5-12,17,20-26,28,40H,13-16H2,1-4H3,(H,35,36)(H,38,39)(H,42,43)/t17-,20-,21+,22+,23-,24+,25+,26-,28+,33-,34-/m0/s1 |
| InChIKey | PTLQDKFYOYMVQN-PZQRPVLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (19115838) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lucensimycin D (CHEBI:199906) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 7-[(2S,3R,4aS,4bS,5'R,6R,7R,8S,8aR,10aR)-5'-[[(2S)-2-acetamido-2-carboxyethyl]sulanylmethyl]-6-acetyloxy-8-hydroxy-4a,7-dimethyl-2',4,4'-trioxospiro[2,4b,5,6,7,8,8a,10a-octahydro-1H-phenanthrene-3,3'-oxolane]-2-yl]hepta-2,4,6-trienoic acid |