EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O9 |
| Net Charge | 0 |
| Average Mass | 376.317 |
| Monoisotopic Mass | 376.07943 |
| SMILES | C/C=C/c1cc2c(c(=O)o1)-c1c(O)c(O)c(OC)c(C(=O)O)c1[C@@H](OC)O2 |
| InChI | InChI=1S/C18H16O9/c1-4-5-7-6-8-9(17(23)26-7)10-11(18(25-3)27-8)12(16(21)22)15(24-2)14(20)13(10)19/h4-6,18-20H,1-3H3,(H,21,22)/b5-4+/t18-/m0/s1 |
| InChIKey | ZORZPKUBRKXKSU-WRFKIARRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyathusspecies (ncbitaxon:1967125) | - | PubMed (18565749) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyathuscavin B (CHEBI:199889) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 9,10-dihydroxy-6,8-dimethoxy-1-oxo-3-[(E)-prop-1-enyl]-6H-pyrano[4,3-c]isochromene-7-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 23342208 | ChemSpider |