EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N2O10 |
| Net Charge | 0 |
| Average Mass | 446.368 |
| Monoisotopic Mass | 446.09614 |
| SMILES | O=C(OC[C@H](NC(=O)[C@@H]1COC(c2cccc(O)c2O)=N1)C(=O)O)c1cccc(O)c1O |
| InChI | InChI=1S/C20H18N2O10/c23-13-5-1-3-9(15(13)25)18-22-11(7-31-18)17(27)21-12(19(28)29)8-32-20(30)10-4-2-6-14(24)16(10)26/h1-6,11-12,23-26H,7-8H2,(H,21,27)(H,28,29)/t11-,12-/m0/s1 |
| InChIKey | COTAVYXDLPLEBS-RYUDHWBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acinetobacter baumannii ATCC 17978 (ncbitaxon:400667) | - | PubMed (23456955) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fimsbactin E (CHEBI:199856) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S)-3-(2,3-dihydroxybenzoyl)oxy-2-[[(4S)-2-(2,3-dihydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440061 | ChemSpider |