EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50N4O7 |
| Net Charge | 0 |
| Average Mass | 578.751 |
| Monoisotopic Mass | 578.36795 |
| SMILES | CCCCC[C@@H](N)[C@@H](O)C(=O)N[C@@H](C(=O)N(C)[C@@H](C(=O)N(C)[C@H](Cc1ccc(O)cc1)C(=O)O)[C@H](C)CC)C(C)C |
| InChI | InChI=1S/C30H50N4O7/c1-8-10-11-12-22(31)26(36)27(37)32-24(18(3)4)28(38)34(7)25(19(5)9-2)29(39)33(6)23(30(40)41)17-20-13-15-21(35)16-14-20/h13-16,18-19,22-26,35-36H,8-12,17,31H2,1-7H3,(H,32,37)(H,40,41)/t19-,22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | UDNHSOSLMVFALQ-GDBHKVHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/s0040-4020(02)01326-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nostoginin BN578 (CHEBI:199847) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-2-[[(2R,3R)-2-[[(2R)-2-[[(2R,3R)-3-amino-2-hydroxyoctanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methylpentanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoic acid |