EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4ClO2 |
| Net Charge | -1 |
| Average Mass | 155.560 |
| Monoisotopic Mass | 154.99053 |
| SMILES | O=C([O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C7H5ClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10)/p-1 |
| InChIKey | LULAYUGMBFYYEX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chlorobenzoate (CHEBI:19984) has functional parent benzoate (CHEBI:16150) |
| 3-chlorobenzoate (CHEBI:19984) is a chlorobenzoate (CHEBI:23133) |
| 3-chlorobenzoate (CHEBI:19984) is conjugate base of 3-chlorobenzoic acid (CHEBI:49410) |
| Incoming Relation(s) |
| 3-chlorobenzoic acid (CHEBI:49410) is conjugate acid of 3-chlorobenzoate (CHEBI:19984) |
| IUPAC Name |
|---|
| 3-chlorobenzoate |
| Synonyms | Source |
|---|---|
| m-chlorobenzoate | ChEBI |
| 3-chlorobenzoic acid, ion(1−) | ChemIDplus |
| mCl-benzoate anion | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| CPD-3486 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:3663 | Gmelin |
| Beilstein:3904773 | Beilstein |
| CAS:16887-60-8 | ChemIDplus |