EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H77N5O10 |
| Net Charge | 0 |
| Average Mass | 848.136 |
| Monoisotopic Mass | 847.56704 |
| SMILES | C#CCCCC(CCCC(=O)N(C)[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)O[C@H](C(=O)N1CCC[C@H]1C(=O)OC)C(C)C)C(C)C)C(C)C)C(C)C)[C@@H](C)CC)OC |
| InChI | InChI=1S/C45H77N5O10/c1-16-18-19-22-32(58-14)23-20-25-34(51)48(12)38(31(11)17-2)41(53)46-35(27(3)4)40(52)47-36(28(5)6)42(54)49(13)37(29(7)8)45(57)60-39(30(9)10)43(55)50-26-21-24-33(50)44(56)59-15/h1,27-33,35-39H,17-26H2,2-15H3,(H,46,53)(H,47,52)/t31-,32?,33-,35-,36-,37-,38-,39-/m0/s1 |
| InChIKey | NMOVUNPLGLJIRX-ZCPVWPFNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria nigro-viridis (ncbitaxon:482564) | - | PubMed (18715036) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Viridamide B (CHEBI:199788) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| methyl (2S)-1-[(2S)-2-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-[5-methoxydec-9-ynoyl(methyl)amino]-3-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]oxy-3-methylbutanoyl]pyrrolidine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 27023479 | ChemSpider |