EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27BrO5 |
| Net Charge | 0 |
| Average Mass | 439.346 |
| Monoisotopic Mass | 438.10419 |
| SMILES | CCOC(=O)[C@]1(O)C(=O)c2c(cc(C)c(Br)c2O)[C@H]2[C@@H](C(C)C)CC[C@]21C |
| InChI | InChI=1S/C21H27BrO5/c1-6-27-19(25)21(26)18(24)14-13(9-11(4)16(22)17(14)23)15-12(10(2)3)7-8-20(15,21)5/h9-10,12,15,23,26H,6-8H2,1-5H3/t12-,15-,20-,21-/m1/s1 |
| InChIKey | NPRIGBNLHQGNEN-SFHVWHCOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hamigera (ncbitaxon:39196) | - | PubMed (23925673) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hamigeran A ethyl ester (CHEBI:199741) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| ethyl (1R,3aR,4R,9bR)-7-bromo-4,6-dihydroxy-3a,8-dimethyl-5-oxo-1-propan-2-yl-1,2,3,9b-tetrahydrocyclopenta[a]naphthalene-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78439609 | ChemSpider |