EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O6 |
| Net Charge | 0 |
| Average Mass | 304.298 |
| Monoisotopic Mass | 304.09469 |
| SMILES | COc1cc(OC)c2c(c1)C(=O)C1=C(C2=O)[C@H](O)O[C@@H](C)C1 |
| InChI | InChI=1S/C16H16O6/c1-7-4-9-13(16(19)22-7)15(18)12-10(14(9)17)5-8(20-2)6-11(12)21-3/h5-7,16,19H,4H2,1-3H3/t7-,16+/m0/s1 |
| InChIKey | PJDRPXKBIRDAFE-HYORBCNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astrosphaeriella (ncbitaxon:682060) | - | PubMed (19431097) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Astropaquinone C (CHEBI:199714) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (1R,3S)-1-hydroxy-7,9-dimethoxy-3-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 58826666 | ChemSpider |