EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H24O14 |
| Net Charge | 0 |
| Average Mass | 584.486 |
| Monoisotopic Mass | 584.11661 |
| SMILES | COC(=O)c1cc(OC)c(O)c(O)c1C(=O)c1cc(C(C)=O)c(O)c(C(=O)c2c(C(=O)OC)cc(OC)c(O)c2O)c1 |
| InChI | InChI=1S/C28H24O14/c1-10(29)12-6-11(20(30)18-13(27(37)41-4)8-16(39-2)23(33)25(18)35)7-15(21(12)31)22(32)19-14(28(38)42-5)9-17(40-3)24(34)26(19)36/h6-9,31,33-36H,1-5H3 |
| InChIKey | LKSMKKXGGYJABY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphisspecies (in: ascomycete fungi) (ncbitaxon:2046666) | - | DOI (10.3987/com-13-12853) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Graphisidin (CHEBI:199675) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| methyl 2-[3-acetyl-5-(2,3-dihydroxy-4-methoxy-6-methoxycarbonylbenzoyl)-4-hydroxybenzoyl]-3,4-dihydroxy-5-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 78434638 | ChemSpider |