EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O3 |
| Net Charge | 0 |
| Average Mass | 270.288 |
| Monoisotopic Mass | 270.10044 |
| SMILES | Cc1cnc(C(=O)[C@@H](O)CO)c2nc3ccccc3c12 |
| InChI | InChI=1S/C15H14N2O3/c1-8-6-16-14(15(20)11(19)7-18)13-12(8)9-4-2-3-5-10(9)17-13/h2-6,11,17-19H,7H2,1H3/t11-/m0/s1 |
| InChIKey | QATLRHOKLQIJNA-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8270489) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxopropaline D (CHEBI:199661) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 2,3-dihydroxy-1-(4-methyl-9H-pyrido[3,4-b]indol-1-yl)propan-1-one |
| Manual Xrefs | Databases |
|---|---|
| 8440611 | ChemSpider |