EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H48O10 |
| Net Charge | 0 |
| Average Mass | 604.737 |
| Monoisotopic Mass | 604.32475 |
| SMILES | CCCCCCCc1cc(O)cc(OC(=O)c2c(CCCCCCC)cc(O)cc2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C33H48O10/c1-3-5-7-9-11-13-21-15-23(35)18-25(16-21)41-32(40)28-22(14-12-10-8-6-4-2)17-24(36)19-26(28)42-33-31(39)30(38)29(37)27(20-34)43-33/h15-19,27,29-31,33-39H,3-14,20H2,1-2H3/t27-,29+,30+,31-,33-/m1/s1 |
| InChIKey | BOTABODRPOJDQC-FLHDZCCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremoniumspecies BCC 14080 (ncbitaxon:523340) | - | PubMed (18363379) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3-heptyl-5-hydroxyphenyl) 2-heptyl-4-hydroxy-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate (CHEBI:199649) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| (3-heptyl-5-hydroxyphenyl) 2-heptyl-4-hydroxy-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 24689719 | ChemSpider |