EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H75N7O10 |
| Net Charge | 0 |
| Average Mass | 826.090 |
| Monoisotopic Mass | 825.55754 |
| SMILES | CC(C)CCCC(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C41H75N7O10/c1-21(2)15-14-16-33(50)48-34(28(13)49)40(56)42-26(11)35(51)44-30(18-23(5)6)37(53)46-32(20-25(9)10)39(55)47-31(19-24(7)8)38(54)45-29(17-22(3)4)36(52)43-27(12)41(57)58/h21-32,34,49H,14-20H2,1-13H3,(H,42,56)(H,43,52)(H,44,51)(H,45,54)(H,46,53)(H,47,55)(H,48,50)(H,57,58)/t26-,27-,28+,29-,30-,31+,32+,34-/m0/s1 |
| InChIKey | RHOHSEZOJCRMKX-CSACJKOTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus indica (ncbitaxon:333964) | - | PubMed (25351611) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Taxlllaid F (CHEBI:199556) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2R)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(5-methylhexanoylamino)butanoyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442481 | ChemSpider |