EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O7 |
| Net Charge | 0 |
| Average Mass | 516.675 |
| Monoisotopic Mass | 516.30870 |
| SMILES | CC1C[C@]2(C[C@@H](C)[C@]3(C[C@H](O)[C@@]4(C)C5=C(C(=O)C[C@]34C)[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3C[C@@H]5O)O2)OC1=O |
| InChI | InChI=1S/C30H44O7/c1-15-11-29(36-24(15)35)12-16(2)30(37-29)14-21(34)28(7)23-17(31)10-19-25(3,4)20(33)8-9-26(19,5)22(23)18(32)13-27(28,30)6/h15-17,19-21,31,33-34H,8-14H2,1-7H3/t15?,16-,17+,19+,20+,21+,26+,27+,28+,29+,30+/m1/s1 |
| InChIKey | KYHKPCGXLKZMBU-YZYPORCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma tropicum (ncbitaxon:36077) | - | PubMed (25690289) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganotropic acid (CHEBI:199554) is a withanolide (CHEBI:74716) |
| Manual Xrefs | Databases |
|---|---|
| 78440778 | ChemSpider |