EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N2O8 |
| Net Charge | 0 |
| Average Mass | 470.478 |
| Monoisotopic Mass | 470.16892 |
| SMILES | C[C@@H]1OC(=O)[C@@H](NC(=O)c2cccc(NC=O)c2O)[C@@H](C)OC(=O)[C@H](Cc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C24H26N2O8/c1-13-19(26-22(30)16-9-6-10-18(21(16)29)25-12-27)24(32)34-14(2)20(28)17(23(31)33-13)11-15-7-4-3-5-8-15/h3-10,12-14,17,19-20,28-29H,11H2,1-2H3,(H,25,27)(H,26,30)/t13-,14+,17-,19+,20+/m1/s1 |
| InChIKey | JWALONHVQNKYEL-FQUQYDMUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CNQ431 (ncbitaxon:1571532) | - | PubMed (19323483) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Splenocin J (CHEBI:199543) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| N-[(2R,3S,6S,7R,8R)-8-benzyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]-3-ormamido-2-hydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 24705279 | ChemSpider |