EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N2O5 |
| Net Charge | 0 |
| Average Mass | 214.177 |
| Monoisotopic Mass | 214.05897 |
| SMILES | N[C@H]1CNC(C(=O)O)=C(CC(=O)O)C1=O |
| InChI | InChI=1S/C8H10N2O5/c9-4-2-10-6(8(14)15)3(7(4)13)1-5(11)12/h4,10H,1-2,9H2,(H,11,12)(H,14,15)/t4-/m0/s1 |
| InChIKey | UXFJYSFCCBPXED-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1271/bbb1961.47.1961) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gostatin (CHEBI:199542) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 3-amino-5-(carboxymethyl)-4-oxo-2,3-dihydro-1H-pyridine-6-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 91339 | ChemSpider |