EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O11 |
| Net Charge | 0 |
| Average Mass | 516.499 |
| Monoisotopic Mass | 516.16316 |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc3c(c(O)c1C2=O)[C@@H](OC1OC(C)C(O)C(O)C1O)C[C@](C)(O)C3 |
| InChI | InChI=1S/C26H28O11/c1-9-19(28)23(32)24(33)25(36-9)37-15-8-26(2,34)7-10-4-12-18(21(30)16(10)15)22(31)17-13(20(12)29)5-11(35-3)6-14(17)27/h4-6,9,15,19,23-25,27-28,30,32-34H,7-8H2,1-3H3/t9?,15-,19?,23?,24?,25?,26+/m0/s1 |
| InChIKey | GBILMBMWCHCXLJ-WJEWAYCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces steffisburgensis (ncbitaxon:68271) | - | PubMed (9268006) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,2'-Demethoxy-steffimycin C (CHEBI:199482) is a anthracycline (CHEBI:48120) |
| IUPAC Name |
|---|
| (7S,9R)-4,6,9-trihydroxy-2-methoxy-9-methyl-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-8,10-dihydro-7H-tetracene-5,12-dione |
| Manual Xrefs | Databases |
|---|---|
| 78445658 | ChemSpider |