EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H58ClN5O8 |
| Net Charge | 0 |
| Average Mass | 772.384 |
| Monoisotopic Mass | 771.39739 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C[C@H](N)CCCCCCCCl)C(=O)N(C)[C@@H](Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C40H58ClN5O8/c1-26(2)22-33(38(51)45(3)35(24-28-14-18-31(48)19-15-28)39(52)46-21-9-11-34(46)40(53)54)44-37(50)32(23-27-12-16-30(47)17-13-27)43-36(49)25-29(42)10-7-5-4-6-8-20-41/h12-19,26,29,32-35,47-48H,4-11,20-25,42H2,1-3H3,(H,43,49)(H,44,50)(H,53,54)/t29-,32+,33+,34+,35+/m1/s1 |
| InChIKey | DRNVSYAWHUZNCC-QDALIAGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/s0040-4020(98)00826-6) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin 99-A (CHEBI:199464) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(3R)-3-amino-10-chlorodecanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8756421 | ChemSpider |