EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O4 |
| Net Charge | 0 |
| Average Mass | 346.382 |
| Monoisotopic Mass | 346.12051 |
| SMILES | O=C(O)C1Cc2ccccc2C=C1C1=Cc2ccccc2CC1C(=O)O |
| InChI | InChI=1S/C22H18O4/c23-21(24)19-11-15-7-3-1-5-13(15)9-17(19)18-10-14-6-2-4-8-16(14)12-20(18)22(25)26/h1-10,19-20H,11-12H2,(H,23,24)(H,25,26) |
| InChIKey | BXDCWQGAILMPMH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fischeri (ncbitaxon:36630) | - | PubMed (21916772) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fisheacid (CHEBI:199462) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 3-(3-carboxy-3,4-dihydronaphthalen-2-yl)-1,2-dihydronaphthalene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434635 | ChemSpider |