EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO4 |
| Net Charge | 0 |
| Average Mass | 221.212 |
| Monoisotopic Mass | 221.06881 |
| SMILES | C=C(Oc1cccc(C(N)=O)c1)C(=O)OC |
| InChI | InChI=1S/C11H11NO4/c1-7(11(14)15-2)16-9-5-3-4-8(6-9)10(12)13/h3-6H,1H2,2H3,(H2,12,13) |
| InChIKey | NWVNXMJELXTRME-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (14563155) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NP25301 (CHEBI:199434) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| methyl 2-(3-carbamoylphenoxy)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 8212012 | ChemSpider |