EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31N5O10 |
| Net Charge | 0 |
| Average Mass | 573.559 |
| Monoisotopic Mass | 573.20709 |
| SMILES | O=C(CNC(=O)C(CCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O)NC1CCCN(O)C1=O |
| InChI | InChI=1S/C26H31N5O10/c32-18-9-1-5-14(21(18)35)23(37)27-11-3-7-16(30-24(38)15-6-2-10-19(33)22(15)36)25(39)28-13-20(34)29-17-8-4-12-31(41)26(17)40/h1-2,5-6,9-10,16-17,32-33,35-36,41H,3-4,7-8,11-13H2,(H,27,37)(H,28,39)(H,29,34)(H,30,38) |
| InChIKey | ILQHJVIKARFYJO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia tenerifensis (ncbitaxon:228006) | - | PubMed (19696806) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-16 (CHEBI:199428) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| N-[4-[(2,3-dihydroxybenzoyl)amino]-5-[[2-[(1-hydroxy-2-oxopiperidin-3-yl)amino]-2-oxoethyl]amino]-5-oxopentyl]-2,3-dihydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 28286916 | ChemSpider |