EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:199394 - 2-amino-3-cyclopropyl-butanoic acid
| Formula | C7H13NO2 |
| Net Charge | 0 |
| Average Mass | 143.186 |
| Monoisotopic Mass | 143.09463 |
| SMILES | CC(C1CC1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H13NO2/c1-4(5-2-3-5)6(8)7(9)10/h4-6H,2-3,8H2,1H3,(H,9,10)/t4?,6-/m0/s1 |
| InChIKey | NAKLBXVLJBZSIP-RZKHNPSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amanita (ncbitaxon:41955) | - | DOI (10.1016/s0031-9422(99)00162-4) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-cyclopropyl-butanoic acid (CHEBI:199394) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-cyclopropylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8877275 | ChemSpider |