EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31ClN4O7 |
| Net Charge | 0 |
| Average Mass | 486.953 |
| Monoisotopic Mass | 486.18813 |
| SMILES | CC(C)(O)[C@H](NC(=O)C[C@@H](N)CCCCN)C(=O)N/C(=C\c1cc(O)c(Cl)c(O)c1)C(=O)O |
| InChI | InChI=1S/C21H31ClN4O7/c1-21(2,33)18(26-16(29)10-12(24)5-3-4-6-23)19(30)25-13(20(31)32)7-11-8-14(27)17(22)15(28)9-11/h7-9,12,18,27-28,33H,3-6,10,23-24H2,1-2H3,(H,25,30)(H,26,29)(H,31,32)/b13-7-/t12-,18+/m0/s1 |
| InChIKey | LGIARSLOMQCKGX-SMOPJJOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (9510908) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Resormycin (CHEBI:199392) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (Z)-3-(4-chloro-3,5-dihydroxyphenyl)-2-[[(2S)-2-[[(3S)-3,7-diaminoheptanoyl]amino]-3-hydroxy-3-methylbutanoyl]amino]prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8776376 | ChemSpider |