EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O8 |
| Net Charge | 0 |
| Average Mass | 334.280 |
| Monoisotopic Mass | 334.06887 |
| SMILES | COC(=O)c1cc(OC)c(O)c2occ(/C(O)=C/C(C)=O)c(=O)c12 |
| InChI | InChI=1S/C16H14O8/c1-7(17)4-10(18)9-6-24-15-12(13(9)19)8(16(21)23-3)5-11(22-2)14(15)20/h4-6,18,20H,1-3H3/b10-4- |
| InChIKey | BFEBUAKVHSKRTL-WMZJFQQLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium lapidosum (ncbitaxon:1328044) | - | DOI (10.1039/p19780001621) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lapidosin (CHEBI:199389) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| methyl 8-hydroxy-3-[(Z)-1-hydroxy-3-oxobut-1-enyl]-7-methoxy-4-oxochromene-5-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 4944687 | ChemSpider |