EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28Cl2O8 |
| Net Charge | 0 |
| Average Mass | 527.397 |
| Monoisotopic Mass | 526.11612 |
| SMILES | CCCC1=CC2=CC(=O)[C@](C)(OC(=O)c3c(C)c(Cl)c(OC)c(Cl)c3OC)[C@@H](OC(C)=O)[C@@H]2CO1 |
| InChI | InChI=1S/C25H28Cl2O8/c1-7-8-15-9-14-10-17(29)25(4,23(34-13(3)28)16(14)11-33-15)35-24(30)18-12(2)19(26)22(32-6)20(27)21(18)31-5/h9-10,16,23H,7-8,11H2,1-6H3/t16-,23+,25+/m1/s1 |
| InChIKey | GJJRTDHSSQUZNO-OYMMJLNRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1248/cpb.40.3142) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Falconensin D (CHEBI:199316) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [(7R,8S,8aS)-8-acetyloxy-7-methyl-6-oxo-3-propyl-8,8a-dihydro-1H-isochromen-7-yl] 3,5-dichloro-2,4-dimethoxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 8545069 | ChemSpider |