EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23N3O5 |
| Net Charge | 0 |
| Average Mass | 289.332 |
| Monoisotopic Mass | 289.16377 |
| SMILES | CC(C)[C@H](N)C(=O)NC(C(=O)O)C1CC(O)C(O)CN1 |
| InChI | InChI=1S/C12H23N3O5/c1-5(2)9(13)11(18)15-10(12(19)20)6-3-7(16)8(17)4-14-6/h5-10,14,16-17H,3-4,13H2,1-2H3,(H,15,18)(H,19,20)/t6?,7?,8?,9-,10?/m0/s1 |
| InChIKey | QSPWYGGTCUYMRY-SPWRCNBUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SANK 60404 (ncbitaxon:1213862) | - | PubMed (28288097) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vazabitide B (CHEBI:199249) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-(4,5-dihydroxypiperidin-2-yl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445035 | ChemSpider |