EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN4O7 |
| Net Charge | 0 |
| Average Mass | 480.905 |
| Monoisotopic Mass | 480.14118 |
| SMILES | Cc1c(Cl)cc2c(c(C3=N[C@@](C)(C(=O)N[C@H](C)C(=O)N[C@@H](CO)C(=O)O)CO3)cn2C)c1O |
| InChI | InChI=1S/C21H25ClN4O7/c1-9-12(22)5-14-15(16(9)28)11(6-26(14)4)18-25-21(3,8-33-18)20(32)23-10(2)17(29)24-13(7-27)19(30)31/h5-6,10,13,27-28H,7-8H2,1-4H3,(H,23,32)(H,24,29)(H,30,31)/t10-,13+,21-/m1/s1 |
| InChIKey | OTAMFIXIIUUMKV-JGMWFTNYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies Sp080513GE-23 (ncbitaxon:630397) | - | PubMed (20146504) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-34 (CHEBI:199241) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-[[(4R)-2-(6-chloro-4-hydroxy-1,5-dimethylindol-3-yl)-4-methyl-5H-1,3-oxazole-4-carbonyl]amino]propanoyl]amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24663430 | ChemSpider |