EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O4 |
| Net Charge | 0 |
| Average Mass | 218.208 |
| Monoisotopic Mass | 218.05791 |
| SMILES | COc1cc(C(=O)O)c(O)c2ccccc12 |
| InChI | InChI=1S/C12H10O4/c1-16-10-6-9(12(14)15)11(13)8-5-3-2-4-7(8)10/h2-6,13H,1H3,(H,14,15) |
| InChIKey | CAXOIULERYZINL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptosporangium (ncbitaxon:2000) | - | PubMed (9510917) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Hydroxy-4-methoxy-2-naphthoic acid (CHEBI:199233) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 1-hydroxy-4-methoxynaphthalene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 21376101 | ChemSpider |