EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N4O5 |
| Net Charge | 0 |
| Average Mass | 334.332 |
| Monoisotopic Mass | 334.12772 |
| SMILES | N[C@H](C(=O)O)[C@@H](c1ccc(O)cc1)n1cncc1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H18N4O5/c16-11(14(21)22)5-9-6-18-7-19(9)13(12(17)15(23)24)8-1-3-10(20)4-2-8/h1-4,6-7,11-13,20H,5,16-17H2,(H,21,22)(H,23,24)/t11-,12-,13+/m0/s1 |
| InChIKey | ATOXYGBPFCBKCE-RWMBFGLXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-(Nπ-L-histidino)-L-tyrosine (CHEBI:19923) is a L-tyrosine derivative (CHEBI:27177) |
| β-(Nπ-L-histidino)-L-tyrosine (CHEBI:19923) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 3-{5-[(2S)-2-amino-2-carboxyethyl]-2-hydroxyphenyl}-L-histidine |