EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33NO3 |
| Net Charge | 0 |
| Average Mass | 383.532 |
| Monoisotopic Mass | 383.24604 |
| SMILES | CCC(=O)C1=CN(CCc2ccccc2)C(C(C)=CC(C)CC)C(C)(O)C1=O |
| InChI | InChI=1S/C24H33NO3/c1-6-17(3)15-18(4)22-24(5,28)23(27)20(21(26)7-2)16-25(22)14-13-19-11-9-8-10-12-19/h8-12,15-17,22,28H,6-7,13-14H2,1-5H3 |
| InChIKey | DICOZIHHHHFBMM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium (ncbitaxon:5506) | - | DOI (10.1016/s0031-9422(96)00433-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Neovasipyridone D (CHEBI:199227) is a primary amine (CHEBI:32877) |
| IUPAC Name |
|---|
| 3-hydroxy-3-methyl-2-(4-methylhex-2-en-2-yl)-1-(2-phenylethyl)-5-propanoyl-2H-pyridin-4-one |
| Manual Xrefs | Databases |
|---|---|
| 78443907 | ChemSpider |