EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16281 - 3-(2-carboxyethenyl)-cis,cis-muconic acid
| Formula | C9H8O6 |
| Net Charge | 0 |
| Average Mass | 212.157 |
| Monoisotopic Mass | 212.03209 |
| SMILES | O=C(O)C=C(/C=C\C(=O)O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H8O6/c10-7(11)3-1-6(5-9(14)15)2-4-8(12)13/h1-5H,(H,10,11)(H,12,13)(H,14,15)/b3-1-,4-2- |
| InChIKey | WKDXBDTUVVLFQV-CCAGOZQPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2-carboxyethenyl)-cis,cis-muconic acid (CHEBI:16281) is a tricarboxylic acid (CHEBI:27093) |
| 3-(2-carboxyethenyl)-cis,cis-muconic acid (CHEBI:16281) is conjugate acid of 3-(2-carboxylatoethenyl)-cis,cis-muconate(3−) (CHEBI:57713) |
| Incoming Relation(s) |
| 3-(2-carboxylatoethenyl)-cis,cis-muconate(3−) (CHEBI:57713) is conjugate base of 3-(2-carboxyethenyl)-cis,cis-muconic acid (CHEBI:16281) |
| IUPAC Name |
|---|
| (2Z,5Z)-4-(carboxymethylidene)hepta-2,5-dienedioic acid |
| Synonyms | Source |
|---|---|
| 3-(2-Carboxyethenyl)-cis,cis-muconate | KEGG COMPOUND |
| 3-(2-carboxyvinyl)-cis,cis-muconate | ChEBI |
| 3-(2-carboxyethenyl)-cis,cis-muconate | ChEBI |