EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO4 |
| Net Charge | 0 |
| Average Mass | 145.114 |
| Monoisotopic Mass | 145.03751 |
| SMILES | CO/[N+]([O-])=C/C=C/C(=O)O |
| InChI | InChI=1S/C5H7NO4/c1-10-6(9)4-2-3-5(7)8/h2-4H,1H3,(H,7,8)/b3-2+,6-4+ |
| InChIKey | HBAKIZJZZAZTAP-WJPDYIDTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (14342596) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(O-methyl-aci-nitro)crotonic acid (CHEBI:199192) is a straight-chain fatty acid (CHEBI:59202) |
| IUPAC Name |
|---|
| (E)-4-hydroxy-N-methoxy-4-oxobut-2-en-1-imine oxide |
| Manual Xrefs | Databases |
|---|---|
| 32989975 | ChemSpider |