EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H29NO10 |
| Net Charge | 0 |
| Average Mass | 563.559 |
| Monoisotopic Mass | 563.17915 |
| SMILES | COc1cc(O)c2c(O)c3c(c4c2c1C1(C4)C(C)=CCCC1(C)C)C1(O)OC12CC(=O)C(C(N)=O)=C(O)C2(O)C3=O |
| InChI | InChI=1S/C30H29NO10/c1-11-6-5-7-26(2,3)27(11)9-12-16-17(13(32)8-15(40-4)21(16)27)22(34)19-20(12)30(39)28(41-30)10-14(33)18(25(31)37)23(35)29(28,38)24(19)36/h6,8,32,34-35,38-39H,5,7,9-10H2,1-4H3,(H2,31,37) |
| InChIKey | ZNUNOBNZBFSHLJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (19168978) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Viridicatumtoxin B (CHEBI:199170) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| 3,9,10,13,15-pentahydroxy-17-methoxy-1',5',5'-trimethyl-7,11-dioxospiro[4-oxahexacyclo[12.6.1.02,12.03,5.05,10.018,21]henicosa-1(21),2(12),8,13,15,17-hexaene-19,6'-cyclohexene]-8-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 78443698 | ChemSpider |