EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H29NO4 |
| Net Charge | 0 |
| Average Mass | 311.422 |
| Monoisotopic Mass | 311.20966 |
| SMILES | [C-]#[N+][C@]1(C)O[C@@H]1[C@H](O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H29NO4/c1-17(18-2)16(22-17)14(19)12-10-8-6-4-3-5-7-9-11-13-15(20)21/h14,16,19H,3-13H2,1H3,(H,20,21)/t14-,16-,17-/m1/s1 |
| InChIKey | CPFRNLPNIWVHAU-DJIMGWMZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora echinospora (ncbitaxon:1877) | - | PubMed (9592568) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YM-47515 (CHEBI:199164) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (13R)-13-hydroxy-13-[(2R,3R)-3-isocyano-3-methyloxiran-2-yl]tridecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436465 | ChemSpider |