EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O3 |
| Net Charge | 0 |
| Average Mass | 396.571 |
| Monoisotopic Mass | 396.26645 |
| SMILES | CC[C@@H](C)[C@H]1O[C@]1(C)[C@@H]1C(C)=C[C@@H]2CC(C)=CC[C@H]2[C@@H]1/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C26H36O3/c1-6-18(3)25-26(5,29-25)24-19(4)16-20-15-17(2)13-14-21(20)22(24)11-9-7-8-10-12-23(27)28/h7-13,16,18,20-22,24-25H,6,14-15H2,1-5H3,(H,27,28)/b8-7+,11-9+,12-10+/t18-,20+,21-,22+,24-,25-,26-/m1/s1 |
| InChIKey | GEGSNPGPRRSEET-YWHCRWFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pyrenulaspecies (ncbitaxon:2530106) | - | PubMed (24926891) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrenulic acid A (CHEBI:199153) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E)-7-[(1S,2S,4aR,8aR)-2-[(2R,3R)-3-[(2R)-butan-2-yl]-2-methyloxiran-2-yl]-3,6-dimethyl-1,2,4a,5,8,8a-hexahydronaphthalen-1-yl]hepta-2,4,6-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 34216771 | ChemSpider |