EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O5 |
| Net Charge | 0 |
| Average Mass | 428.569 |
| Monoisotopic Mass | 428.25627 |
| SMILES | C=C1[C@H]([C@@H](C)CC)O[C@@H](/C=C/C=C/C(=O)O)[C@H](O)[C@@H]2[C@H]3CC=C(C)C[C@@H]3C=C(C)[C@]12O |
| InChI | InChI=1S/C26H36O5/c1-6-16(3)25-18(5)26(30)17(4)14-19-13-15(2)11-12-20(19)23(26)24(29)21(31-25)9-7-8-10-22(27)28/h7-11,14,16,19-21,23-25,29-30H,5-6,12-13H2,1-4H3,(H,27,28)/b9-7+,10-8+/t16-,19+,20-,21-,23-,24-,25-,26-/m0/s1 |
| InChIKey | RNNQLHOUBURQQV-QWFBGHQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pyrenulaspecies (ncbitaxon:2530106) | - | PubMed (24926891) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrenulic acid H (CHEBI:199134) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1R,2S,4S,5aS,7aS,11aS,11bS)-4-[(2S)-butan-2-yl]-1,5a-dihydroxy-6,9-dimethyl-5-methylidene-2,7a,8,11,11a,11b-hexahydro-1H-benzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436462 | ChemSpider |