EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26O9 |
| Net Charge | 0 |
| Average Mass | 554.551 |
| Monoisotopic Mass | 554.15768 |
| SMILES | COc1cc(OC)c2c3c(c(O)c(-c4c(OC)c5c(cc(O)c6c(O)cc(C)oc65)cc4=O)c2c1)C(=O)C=C(C)C3 |
| InChI | InChI=1S/C32H26O9/c1-13-6-17-25-18(11-16(38-3)12-23(25)39-4)27(30(37)26(17)19(33)7-13)29-22(36)10-15-9-21(35)28-20(34)8-14(2)41-32(28)24(15)31(29)40-5/h7-12,34-35,37H,6H2,1-5H3 |
| InChIKey | KVCRJELRKNDEHT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (23847065) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperpyrone E (CHEBI:199132) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 4,5-dihydroxy-9-(10-hydroxy-5,7-dimethoxy-3-methyl-1-oxo-4H-phenanthren-9-yl)-10-methoxy-2-methylbenzo[h]chromen-8-one |
| Manual Xrefs | Databases |
|---|---|
| 78435574 | ChemSpider |