EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O4 |
| Net Charge | 0 |
| Average Mass | 286.287 |
| Monoisotopic Mass | 286.09536 |
| SMILES | O=C(O)CNC(=O)c1ccc([C@H](O)c2ccccc2)cn1 |
| InChI | InChI=1S/C15H14N2O4/c18-13(19)9-17-15(21)12-7-6-11(8-16-12)14(20)10-4-2-1-3-5-10/h1-8,14,20H,9H2,(H,17,21)(H,18,19)/t14-/m1/s1 |
| InChIKey | FXLBJCPJRLNNME-CQSZACIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Akanthomyces lecanii (ncbitaxon:2714763) | - | DOI (10.1021/np000094q) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vertilecanin B (CHEBI:199090) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[5-[(R)-hydroxy(phenyl)methyl]pyridine-2-carbonyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 8883670 | ChemSpider |