EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O4 |
| Net Charge | 0 |
| Average Mass | 304.386 |
| Monoisotopic Mass | 304.16746 |
| SMILES | C[C@@H]1CC(C(=O)O)C[C@@H]2C=C[C@H](C)[C@H](/C=C/C=C/C(=O)O)[C@@H]12 |
| InChI | InChI=1S/C18H24O4/c1-11-7-8-13-10-14(18(21)22)9-12(2)17(13)15(11)5-3-4-6-16(19)20/h3-8,11-15,17H,9-10H2,1-2H3,(H,19,20)(H,21,22)/b5-3+,6-4+/t11-,12+,13-,14?,15-,17-/m0/s1 |
| InChIKey | CTZUNMXSKIMIEE-GNUZFWQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium steckii (ncbitaxon:303698) | - | DOI (10.1016/s0031-9422(00)00106-0) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanzawaic acid F (CHEBI:199033) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (4R,4aS,5S,6S,8aR)-5-[(1E,3E)-4-carboxybuta-1,3-dienyl]-4,6-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 10478268 | ChemSpider |