EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H42ClN7O8 |
| Net Charge | 0 |
| Average Mass | 736.226 |
| Monoisotopic Mass | 735.27834 |
| SMILES | C=C(C)c1cnc2ccccc2c1-c1cc(C(=O)NC(C(=O)N2CC[C@@](C)(O)[C@H]2C(=O)NC(C(=O)O)=C(C)C)C(Cl)C(O)CN=C(N)N)ccc1O |
| InChI | InChI=1S/C36H42ClN7O8/c1-17(2)22-15-40-23-9-7-6-8-20(23)26(22)21-14-19(10-11-24(21)45)31(47)43-29(27(37)25(46)16-41-35(38)39)33(49)44-13-12-36(5,52)30(44)32(48)42-28(18(3)4)34(50)51/h6-11,14-15,25,27,29-30,45-46,52H,1,12-13,16H2,2-5H3,(H,42,48)(H,43,47)(H,50,51)(H4,38,39,41)/t25?,27?,29?,30-,36-/m1/s1 |
| InChIKey | UIKSOMFXGWTAID-DUUDCQCKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Helicomyces (ncbitaxon:301201) | - | PubMed (14563156) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR225659 (CHEBI:199026) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 2-[[(2S,3R)-1-[3-chloro-5-(diaminomethylideneamino)-4-hydroxy-2-[[4-hydroxy-3-(3-prop-1-en-2-ylquinolin-4-yl)benzoyl]amino]pentanoyl]-3-hydroxy-3-methylpyrrolidine-2-carbonyl]amino]-3-methylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445032 | ChemSpider |