EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N6O6 |
| Net Charge | 0 |
| Average Mass | 550.616 |
| Monoisotopic Mass | 550.25398 |
| SMILES | C[C@@H]1NC(=O)c2ccccc2NC(=O)[C@H](C)N(C)C(=O)[C@H](C)NC(=O)c2ccccc2NC(=O)[C@H](C)N(C)C1=O |
| InChI | InChI=1S/C28H34N6O6/c1-15-27(39)33(5)17(3)23(35)32-22-14-10-8-12-20(22)26(38)30-16(2)28(40)34(6)18(4)24(36)31-21-13-9-7-11-19(21)25(37)29-15/h7-18H,1-6H3,(H,29,37)(H,30,38)(H,31,36)(H,32,35)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | ZMSUXAYRLPGMIN-XSLAGTTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25246036) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Versicotide C (CHEBI:199015) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (4S,7S,18S,21S)-4,5,7,18,19,21-hexamethyl-2,5,8,16,19,22-hexazatricyclo[22.4.0.010,15]octacosa-1(28),10,12,14,24,26-hexaene-3,6,9,17,20,23-hexone |
| Manual Xrefs | Databases |
|---|---|
| 34981404 | ChemSpider |