EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O7S |
| Net Charge | 0 |
| Average Mass | 380.378 |
| Monoisotopic Mass | 380.06782 |
| SMILES | C=C1Oc2cc(OC)cc(C(=O)SC[C@H](NC(C)=O)C(=O)O)c2NC1=O |
| InChI | InChI=1S/C16H16N2O7S/c1-7-14(20)18-13-10(4-9(24-3)5-12(13)25-7)16(23)26-6-11(15(21)22)17-8(2)19/h4-5,11H,1,6H2,2-3H3,(H,17,19)(H,18,20)(H,21,22)/t11-/m0/s1 |
| InChIKey | YGSOEFLROPFWTN-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (21505471) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzoxacystol (CHEBI:198994) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-(7-methoxy-2-methylidene-3-oxo-4H-1,4-benzoxazine-5-carbonyl)sulanylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 27025656 | ChemSpider |